About (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate
(1-methylpiperidin-4-yl) N-propan-2-ylcarbamate (PubChem CID 15229089) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate |
| PubChem CID | 15229089 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OC1CCN(C)CC1 |
| InChI | InChI=1S/C10H20N2O2/c1-8(2)11-10(13)14-9-4-6-12(3)7-5-9/h8-9H,4-7H2,1-3H3,(H,11,13) |
| InChIKey | RZYOUORFSDOOQC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate?
The IUPAC name of (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate (CID 15229089) is (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate.
What is the SMILES notation for (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate?
The canonical SMILES for (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate is CC(C)NC(=O)OC1CCN(C)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate?
The InChIKey is RZYOUORFSDOOQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-8(2)11-10(13)14-9-4-6-12(3)7-5-9/h8-9H,4-7H2,1-3H3,(H,11,13).
What are the key properties of (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate?
(1-methylpiperidin-4-yl) N-propan-2-ylcarbamate has a molecular weight of 200.28 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) N-propan-2-ylcarbamate is sourced from PubChem (CID 15229089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).