About ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate
ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate (PubChem CID 15229191) has the molecular formula C20H20O3S
and a molecular weight of 340.44 g/mol. Its IUPAC name is ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate |
| PubChem CID | 15229191 |
| Molecular Formula | C20H20O3S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(C)(C)CCS3)o1 |
| InChI | InChI=1S/C20H20O3S/c1-4-22-19(21)17-9-8-15(23-17)7-5-14-6-10-18-16(13-14)20(2,3)11-12-24-18/h6,8-10,13H,4,11-12H2,1-3H3 |
| InChIKey | XSWKPRIIXJOQRB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate?
The IUPAC name of ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate (CID 15229191) is ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate.
What is the SMILES notation for ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate?
The canonical SMILES for ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate is CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(C)(C)CCS3)o1.
What is the InChIKey of ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate?
The InChIKey is XSWKPRIIXJOQRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O3S/c1-4-22-19(21)17-9-8-15(23-17)7-5-14-6-10-18-16(13-14)20(2,3)11-12-24-18/h6,8-10,13H,4,11-12H2,1-3H3.
What are the key properties of ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate?
ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate has a molecular weight of 340.44 g/mol, XLogP of 4.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]furan-2-carboxylate is sourced from PubChem (CID 15229191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).