C13H8ClFN4O3S — CID 15229391
ethyl 7-chloro-6-fluoro-4-oxo-1-(1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylate (PubChem CID 15229391) has the molecular formula C13H8ClFN4O3S and a molecular weight of 354.75 g/mol. Its IUPAC name is ethyl 7-chloro-6-fluoro-4-oxo-1-(1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7-chloro-6-fluoro-4-oxo-1-(1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 15229391 |
| Molecular Formula | C13H8ClFN4O3S |
| Molecular Weight | 354.75 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | ethyl 7-chloro-6-fluoro-4-oxo-1-(1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ncns2)c2nc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C13H8ClFN4O3S/c1-2-22-12(21)7-4-19(13-16-5-17-23-13)11-6(9(7)20)3-8(15)10(14)18-11/h3-5H,2H2,1H3 |
| InChIKey | MWYJAGHZOILBEZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|