C16H14FN3 — CID 15229562
2-(2-fluorophenyl)-6,7,8,9-tetrahydro-5H-pyrimido[5,4-b]indole (PubChem CID 15229562) has the molecular formula C16H14FN3 and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-6,7,8,9-tetrahydro-5H-pyrimido[5,4-b]indole.
| Compound Name | 2-(2-fluorophenyl)-6,7,8,9-tetrahydro-5H-pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 15229562 |
| Molecular Formula | C16H14FN3 |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-(2-fluorophenyl)-6,7,8,9-tetrahydro-5H-pyrimido[5,4-b]indole |
| SMILES | Fc1ccccc1-c1ncc2[nH]c3c(c2n1)CCCC3 |
| InChI | InChI=1S/C16H14FN3/c17-12-7-3-1-5-10(12)16-18-9-14-15(20-16)11-6-2-4-8-13(11)19-14/h1,3,5,7,9,19H,2,4,6,8H2 |
| InChIKey | SZYDUOPUPTYZFY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |