C18H16FN3O2 — CID 15229584
2'-(2-fluorophenyl)spiro[1,3-dioxolane-2,8'-5,6,7,9-tetrahydropyrimido[5,4-b]indole] (PubChem CID 15229584) has the molecular formula C18H16FN3O2 and a molecular weight of 325.34 g/mol. Its IUPAC name is 2'-(2-fluorophenyl)spiro[1,3-dioxolane-2,8'-5,6,7,9-tetrahydropyrimido[5,4-b]indole].
| Compound Name | 2'-(2-fluorophenyl)spiro[1,3-dioxolane-2,8'-5,6,7,9-tetrahydropyrimido[5,4-b]indole] |
|---|---|
| PubChem CID | 15229584 |
| Molecular Formula | C18H16FN3O2 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2'-(2-fluorophenyl)spiro[1,3-dioxolane-2,8'-5,6,7,9-tetrahydropyrimido[5,4-b]indole] |
| SMILES | Fc1ccccc1-c1ncc2[nH]c3c(c2n1)CC1(CC3)OCCO1 |
| InChI | InChI=1S/C18H16FN3O2/c19-13-4-2-1-3-11(13)17-20-10-15-16(22-17)12-9-18(23-7-8-24-18)6-5-14(12)21-15/h1-4,10,21H,5-9H2 |
| InChIKey | WQPOZXOIEXAUIL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |