C22H21FN2O2 — CID 15230092
1-(4-fluorophenyl)-7-[(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydroindazole-3-carbaldehyde (PubChem CID 15230092) has the molecular formula C22H21FN2O2 and a molecular weight of 364.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-7-[(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydroindazole-3-carbaldehyde.
| Compound Name | 1-(4-fluorophenyl)-7-[(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydroindazole-3-carbaldehyde |
|---|---|
| PubChem CID | 15230092 |
| Molecular Formula | C22H21FN2O2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-(4-fluorophenyl)-7-[(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydroindazole-3-carbaldehyde |
| SMILES | COc1ccc(CC2CCCc3c(C=O)nn(-c4ccc(F)cc4)c32)cc1 |
| InChI | InChI=1S/C22H21FN2O2/c1-27-19-11-5-15(6-12-19)13-16-3-2-4-20-21(14-26)24-25(22(16)20)18-9-7-17(23)8-10-18/h5-12,14,16H,2-4,13H2,1H3 |
| InChIKey | FRJPJBMILQXBLD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|