C25H29Cl2N3O3 — CID 15230559
6-chloro-2-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 15230559) has the molecular formula C25H29Cl2N3O3 and a molecular weight of 490.43 g/mol. Its IUPAC name is 6-chloro-2-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-chloro-2-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 15230559 |
| Molecular Formula | C25H29Cl2N3O3 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 6-chloro-2-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2ccc(Cl)cc2CCN1CCCCN1CCN(c2cc(Cl)cc3c2OCCO3)CC1 |
| InChI | InChI=1S/C25H29Cl2N3O3/c26-19-3-4-21-18(15-19)5-8-30(25(21)31)7-2-1-6-28-9-11-29(12-10-28)22-16-20(27)17-23-24(22)33-14-13-32-23/h3-4,15-17H,1-2,5-14H2 |
| InChIKey | ORUYRDQZAWUYEB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|