C23H26ClN3O3S — CID 15230560
2-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-1,2-benzothiazol-3-one (PubChem CID 15230560) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is 2-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-1,2-benzothiazol-3-one.
| Compound Name | 2-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 15230560 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-1,2-benzothiazol-3-one |
| SMILES | O=c1c2ccccc2sn1CCCCN1CCN(c2cc(Cl)cc3c2OCCO3)CC1 |
| InChI | InChI=1S/C23H26ClN3O3S/c24-17-15-19(22-20(16-17)29-13-14-30-22)26-11-9-25(10-12-26)7-3-4-8-27-23(28)18-5-1-2-6-21(18)31-27/h1-2,5-6,15-16H,3-4,7-14H2 |
| InChIKey | KLBRJCHTSAGTBN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|