C22H28O3 — CID 15230860
2-(7-hydroxy-1-phenylheptyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 15230860) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 2-(7-hydroxy-1-phenylheptyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(7-hydroxy-1-phenylheptyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 15230860 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2-(7-hydroxy-1-phenylheptyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(C(CCCCCCO)c2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C22H28O3/c1-15-16(2)22(25)20(17(3)21(15)24)19(13-9-4-5-10-14-23)18-11-7-6-8-12-18/h6-8,11-12,19,23H,4-5,9-10,13-14H2,1-3H3 |
| InChIKey | GDTKQVSBONGHKE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|