C16H22O3S — CID 15231931
(2R,6R)-2-[1-(benzenesulfonyl)ethyl]-6-ethyl-5-methyl-3,6-dihydro-2H-pyran (PubChem CID 15231931) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is (2R,6R)-2-[1-(benzenesulfonyl)ethyl]-6-ethyl-5-methyl-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-2-[1-(benzenesulfonyl)ethyl]-6-ethyl-5-methyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 15231931 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2R,6R)-2-[1-(benzenesulfonyl)ethyl]-6-ethyl-5-methyl-3,6-dihydro-2H-pyran |
| SMILES | CC[C@H]1O[C@@H](C(C)S(=O)(=O)c2ccccc2)CC=C1C |
| InChI | InChI=1S/C16H22O3S/c1-4-15-12(2)10-11-16(19-15)13(3)20(17,18)14-8-6-5-7-9-14/h5-10,13,15-16H,4,11H2,1-3H3/t13?,15-,16-/m1/s1 |
| InChIKey | ODMMUKQBLCQQRR-GNHXQJIDSA-N |
| XLogP | 3.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|