C17H16N2 — CID 15232193
2-phenyl-6,7,8,9-tetrahydro-5H-pyrido[3,2-b]indole (PubChem CID 15232193) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-phenyl-6,7,8,9-tetrahydro-5H-pyrido[3,2-b]indole.
| Compound Name | 2-phenyl-6,7,8,9-tetrahydro-5H-pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 15232193 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-phenyl-6,7,8,9-tetrahydro-5H-pyrido[3,2-b]indole |
| SMILES | c1ccc(-c2ccc3[nH]c4c(c3n2)CCCC4)cc1 |
| InChI | InChI=1S/C17H16N2/c1-2-6-12(7-3-1)14-10-11-16-17(19-14)13-8-4-5-9-15(13)18-16/h1-3,6-7,10-11,18H,4-5,8-9H2 |
| InChIKey | XKGHNAZRLNNKSP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |