C17H18N2O4 — CID 15232404
2-[(5R,6R,7R)-2,2,5-trimethyl-8-oxo-3-oxa-1-azabicyclo[4.2.0]octan-7-yl]isoindole-1,3-dione (PubChem CID 15232404) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-[(5R,6R,7R)-2,2,5-trimethyl-8-oxo-3-oxa-1-azabicyclo[4.2.0]octan-7-yl]isoindole-1,3-dione.
| Compound Name | 2-[(5R,6R,7R)-2,2,5-trimethyl-8-oxo-3-oxa-1-azabicyclo[4.2.0]octan-7-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15232404 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-[(5R,6R,7R)-2,2,5-trimethyl-8-oxo-3-oxa-1-azabicyclo[4.2.0]octan-7-yl]isoindole-1,3-dione |
| SMILES | C[C@H]1COC(C)(C)N2C(=O)[C@H](N3C(=O)c4ccccc4C3=O)[C@@H]12 |
| InChI | InChI=1S/C17H18N2O4/c1-9-8-23-17(2,3)19-12(9)13(16(19)22)18-14(20)10-6-4-5-7-11(10)15(18)21/h4-7,9,12-13H,8H2,1-3H3/t9-,12+,13+/m0/s1 |
| InChIKey | MFUNYORVPXAOJQ-ZWKOPEQDSA-N |
| XLogP | 1.26 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|