C19H32FN3 — CID 15232718
N'-[[(3S,4S)-4-(4-fluorophenyl)-1-pentylpiperidin-3-yl]methyl]ethane-1,2-diamine (PubChem CID 15232718) has the molecular formula C19H32FN3 and a molecular weight of 321.48 g/mol. Its IUPAC name is N'-[[(3S,4S)-4-(4-fluorophenyl)-1-pentylpiperidin-3-yl]methyl]ethane-1,2-diamine.
| Compound Name | N'-[[(3S,4S)-4-(4-fluorophenyl)-1-pentylpiperidin-3-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 15232718 |
| Molecular Formula | C19H32FN3 |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.26 |
| IUPAC Name | N'-[[(3S,4S)-4-(4-fluorophenyl)-1-pentylpiperidin-3-yl]methyl]ethane-1,2-diamine |
| SMILES | CCCCCN1CC[C@H](c2ccc(F)cc2)[C@@H](CNCCN)C1 |
| InChI | InChI=1S/C19H32FN3/c1-2-3-4-12-23-13-9-19(16-5-7-18(20)8-6-16)17(15-23)14-22-11-10-21/h5-8,17,19,22H,2-4,9-15,21H2,1H3/t17-,19+/m0/s1 |
| InChIKey | PNJDXHXOZSKFKR-PKOBYXMFSA-N |
| XLogP | 2.97 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|