C20H34FN3 — CID 15232719
N'-[[(3S,4S)-4-(4-fluorophenyl)-1-pentylpiperidin-3-yl]methyl]propane-1,3-diamine (PubChem CID 15232719) has the molecular formula C20H34FN3 and a molecular weight of 335.51 g/mol. Its IUPAC name is N'-[[(3S,4S)-4-(4-fluorophenyl)-1-pentylpiperidin-3-yl]methyl]propane-1,3-diamine.
| Compound Name | N'-[[(3S,4S)-4-(4-fluorophenyl)-1-pentylpiperidin-3-yl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 15232719 |
| Molecular Formula | C20H34FN3 |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.27 |
| IUPAC Name | N'-[[(3S,4S)-4-(4-fluorophenyl)-1-pentylpiperidin-3-yl]methyl]propane-1,3-diamine |
| SMILES | CCCCCN1CC[C@H](c2ccc(F)cc2)[C@@H](CNCCCN)C1 |
| InChI | InChI=1S/C20H34FN3/c1-2-3-4-13-24-14-10-20(17-6-8-19(21)9-7-17)18(16-24)15-23-12-5-11-22/h6-9,18,20,23H,2-5,10-16,22H2,1H3/t18-,20+/m0/s1 |
| InChIKey | YNYKCTFHKKTCEZ-AZUAARDMSA-N |
| XLogP | 3.36 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|