C13H18BrNO — CID 15233126
(2R,6R)-4-[(4-bromophenyl)methyl]-2,6-dimethylmorpholine (PubChem CID 15233126) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is (2R,6R)-4-[(4-bromophenyl)methyl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6R)-4-[(4-bromophenyl)methyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 15233126 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (2R,6R)-4-[(4-bromophenyl)methyl]-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(Cc2ccc(Br)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C13H18BrNO/c1-10-7-15(8-11(2)16-10)9-12-3-5-13(14)6-4-12/h3-6,10-11H,7-9H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | DXFLVWNNYJNMTO-GHMZBOCLSA-N |
| XLogP | 3.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |