About (1-benzylpiperidin-4-yl) N-phenylcarbamate
(1-benzylpiperidin-4-yl) N-phenylcarbamate (PubChem CID 15233435) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl) N-phenylcarbamate.
Molecular Properties
| Compound Name | (1-benzylpiperidin-4-yl) N-phenylcarbamate |
| PubChem CID | 15233435 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (1-benzylpiperidin-4-yl) N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N2O2/c22-19(20-17-9-5-2-6-10-17)23-18-11-13-21(14-12-18)15-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H,20,22) |
| InChIKey | HGOQLBZCERINRQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-benzylpiperidin-4-yl) N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzylpiperidin-4-yl) N-phenylcarbamate?
The IUPAC name of (1-benzylpiperidin-4-yl) N-phenylcarbamate (CID 15233435) is (1-benzylpiperidin-4-yl) N-phenylcarbamate.
What is the SMILES notation for (1-benzylpiperidin-4-yl) N-phenylcarbamate?
The canonical SMILES for (1-benzylpiperidin-4-yl) N-phenylcarbamate is O=C(Nc1ccccc1)OC1CCN(Cc2ccccc2)CC1.
What is the InChIKey of (1-benzylpiperidin-4-yl) N-phenylcarbamate?
The InChIKey is HGOQLBZCERINRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2/c22-19(20-17-9-5-2-6-10-17)23-18-11-13-21(14-12-18)15-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H,20,22).
What are the key properties of (1-benzylpiperidin-4-yl) N-phenylcarbamate?
(1-benzylpiperidin-4-yl) N-phenylcarbamate has a molecular weight of 310.40 g/mol, XLogP of 3.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzylpiperidin-4-yl) N-phenylcarbamate is sourced from PubChem (CID 15233435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).