About methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate
methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate (PubChem CID 15233513) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate |
| PubChem CID | 15233513 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=CC(=O)N1 |
| InChI | InChI=1S/C7H9NO3/c1-11-7(10)5-3-2-4-6(9)8-5/h2,4-5H,3H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | RPKWELAXGRBXSO-YFKPBYRVSA-N |
| XLogP | -0.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate?
The IUPAC name of methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate (CID 15233513) is methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate.
What is the SMILES notation for methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate?
The canonical SMILES for methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate is COC(=O)[C@@H]1CC=CC(=O)N1.
What is the InChIKey of methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate?
The InChIKey is RPKWELAXGRBXSO-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H9NO3/c1-11-7(10)5-3-2-4-6(9)8-5/h2,4-5H,3H2,1H3,(H,8,9)/t5-/m0/s1.
What are the key properties of methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate?
methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate has a molecular weight of 155.15 g/mol, XLogP of -0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate is sourced from PubChem (CID 15233513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).