methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate

C7H9NO3 — CID 15233513

IUPACmethyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate
SMILESCOC(=O)[C@@H]1CC=CC(=O)N1
InChIInChI=1S/C7H9NO3/c1-11-7(10)5-3-2-4-6(9)8-5/h2,4-5H,3H2,1H3,(H,8,9)/t5-/m0/s1
InChIKeyRPKWELAXGRBXSO-YFKPBYRVSA-N
MW155.15 g/mol
LogP-0.40
Rot. Bonds1

About methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate

methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate (PubChem CID 15233513) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate
PubChem CID15233513
Molecular FormulaC7H9NO3
Molecular Weight155.15 g/mol
Exact Mass155.06
IUPAC Namemethyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate
SMILESCOC(=O)[C@@H]1CC=CC(=O)N1
InChIInChI=1S/C7H9NO3/c1-11-7(10)5-3-2-4-6(9)8-5/h2,4-5H,3H2,1H3,(H,8,9)/t5-/m0/s1
InChIKeyRPKWELAXGRBXSO-YFKPBYRVSA-N
XLogP-0.40
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.15
LogP ≤ 5-0.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate?
The IUPAC name of methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate (CID 15233513) is methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate.
What is the SMILES notation for methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate?
The canonical SMILES for methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate is COC(=O)[C@@H]1CC=CC(=O)N1.
What is the InChIKey of methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate?
The InChIKey is RPKWELAXGRBXSO-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H9NO3/c1-11-7(10)5-3-2-4-6(9)8-5/h2,4-5H,3H2,1H3,(H,8,9)/t5-/m0/s1.
What are the key properties of methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate?
methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate has a molecular weight of 155.15 g/mol, XLogP of -0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylate is sourced from PubChem (CID 15233513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).