About 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol
6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol (PubChem CID 15233562) has the molecular formula C19H16O4
and a molecular weight of 308.33 g/mol. Its IUPAC name is 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol.
Molecular Properties
| Compound Name | 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol |
| PubChem CID | 15233562 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol |
| SMILES | CC1(C)C=Cc2c(ccc(-c3cc4ccc(O)cc4o3)c2O)O1 |
| InChI | InChI=1S/C19H16O4/c1-19(2)8-7-14-15(23-19)6-5-13(18(14)21)17-9-11-3-4-12(20)10-16(11)22-17/h3-10,20-21H,1-2H3 |
| InChIKey | AOVQEAUIBICOLQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol?
The IUPAC name of 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol (CID 15233562) is 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol.
What is the SMILES notation for 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol?
The canonical SMILES for 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol is CC1(C)C=Cc2c(ccc(-c3cc4ccc(O)cc4o3)c2O)O1.
What is the InChIKey of 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol?
The InChIKey is AOVQEAUIBICOLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O4/c1-19(2)8-7-14-15(23-19)6-5-13(18(14)21)17-9-11-3-4-12(20)10-16(11)22-17/h3-10,20-21H,1-2H3.
What are the key properties of 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol?
6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol has a molecular weight of 308.33 g/mol, XLogP of 4.70, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethylchromen-5-ol is sourced from PubChem (CID 15233562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).