C18H21I3N2O6 — CID 15233596
(5-ethoxy-5-oxopentyl) 3,5-diacetamido-2,4,6-triiodobenzoate (PubChem CID 15233596) has the molecular formula C18H21I3N2O6 and a molecular weight of 742.09 g/mol. Its IUPAC name is (5-ethoxy-5-oxopentyl) 3,5-diacetamido-2,4,6-triiodobenzoate.
| Compound Name | (5-ethoxy-5-oxopentyl) 3,5-diacetamido-2,4,6-triiodobenzoate |
|---|---|
| PubChem CID | 15233596 |
| Molecular Formula | C18H21I3N2O6 |
| Molecular Weight | 742.09 g/mol |
| Exact Mass | 741.85 |
| IUPAC Name | (5-ethoxy-5-oxopentyl) 3,5-diacetamido-2,4,6-triiodobenzoate |
| SMILES | CCOC(=O)CCCCOC(=O)c1c(I)c(NC(C)=O)c(I)c(NC(C)=O)c1I |
| InChI | InChI=1S/C18H21I3N2O6/c1-4-28-11(26)7-5-6-8-29-18(27)12-13(19)16(22-9(2)24)15(21)17(14(12)20)23-10(3)25/h4-8H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | AVOSOMZOWGLDHQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.09 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|