C9H19NO6P2 — CID 15234320
(2-methyl-5-phosphono-1,2,3,4,4a,6,7,7a-octahydrocyclopenta[b]pyridin-5-yl)phosphonic acid (PubChem CID 15234320) has the molecular formula C9H19NO6P2 and a molecular weight of 299.20 g/mol. Its IUPAC name is (2-methyl-5-phosphono-1,2,3,4,4a,6,7,7a-octahydrocyclopenta[b]pyridin-5-yl)phosphonic acid.
| Compound Name | (2-methyl-5-phosphono-1,2,3,4,4a,6,7,7a-octahydrocyclopenta[b]pyridin-5-yl)phosphonic acid |
|---|---|
| PubChem CID | 15234320 |
| Molecular Formula | C9H19NO6P2 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (2-methyl-5-phosphono-1,2,3,4,4a,6,7,7a-octahydrocyclopenta[b]pyridin-5-yl)phosphonic acid |
| SMILES | CC1CCC2C(CCC2(P(=O)(O)O)P(=O)(O)O)N1 |
| InChI | InChI=1S/C9H19NO6P2/c1-6-2-3-7-8(10-6)4-5-9(7,17(11,12)13)18(14,15)16/h6-8,10H,2-5H2,1H3,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | FKYHIXZGAGOLAY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|