About 3-methyl-1H-indole-4,7-dione
3-methyl-1H-indole-4,7-dione (PubChem CID 15234399) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is 3-methyl-1H-indole-4,7-dione.
Molecular Properties
| Compound Name | 3-methyl-1H-indole-4,7-dione |
| PubChem CID | 15234399 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 3-methyl-1H-indole-4,7-dione |
| SMILES | Cc1c[nH]c2c1C(=O)C=CC2=O |
| InChI | InChI=1S/C9H7NO2/c1-5-4-10-9-7(12)3-2-6(11)8(5)9/h2-4,10H,1H3 |
| InChIKey | NBLMSWMRHABSLG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1H-indole-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1H-indole-4,7-dione?
The IUPAC name of 3-methyl-1H-indole-4,7-dione (CID 15234399) is 3-methyl-1H-indole-4,7-dione.
What is the SMILES notation for 3-methyl-1H-indole-4,7-dione?
The canonical SMILES for 3-methyl-1H-indole-4,7-dione is Cc1c[nH]c2c1C(=O)C=CC2=O.
What is the InChIKey of 3-methyl-1H-indole-4,7-dione?
The InChIKey is NBLMSWMRHABSLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c1-5-4-10-9-7(12)3-2-6(11)8(5)9/h2-4,10H,1H3.
What are the key properties of 3-methyl-1H-indole-4,7-dione?
3-methyl-1H-indole-4,7-dione has a molecular weight of 161.16 g/mol, XLogP of 1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1H-indole-4,7-dione is sourced from PubChem (CID 15234399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).