C22H35N5O7 — CID 15234530
(2S)-2-[[(2S)-3-carboxy-2-[[2-[ethyl(6-imidazol-1-ylhexanoyl)amino]acetyl]amino]propanoyl]amino]-3-methylbutanoic acid (PubChem CID 15234530) has the molecular formula C22H35N5O7 and a molecular weight of 481.55 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-carboxy-2-[[2-[ethyl(6-imidazol-1-ylhexanoyl)amino]acetyl]amino]propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-carboxy-2-[[2-[ethyl(6-imidazol-1-ylhexanoyl)amino]acetyl]amino]propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 15234530 |
| Molecular Formula | C22H35N5O7 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | (2S)-2-[[(2S)-3-carboxy-2-[[2-[ethyl(6-imidazol-1-ylhexanoyl)amino]acetyl]amino]propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CCN(CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)O)C(C)C)C(=O)CCCCCn1ccnc1 |
| InChI | InChI=1S/C22H35N5O7/c1-4-27(18(29)8-6-5-7-10-26-11-9-23-14-26)13-17(28)24-16(12-19(30)31)21(32)25-20(15(2)3)22(33)34/h9,11,14-16,20H,4-8,10,12-13H2,1-3H3,(H,24,28)(H,25,32)(H,30,31)(H,33,34)/t16-,20-/m0/s1 |
| InChIKey | CCAUNJTXIAPZGV-JXFKEZNVSA-N |
| XLogP | 0.48 |
| TPSA | 170.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|