C23H24N4O3S — CID 15236323
2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-N-hydroxybenzenesulfonamide (PubChem CID 15236323) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-N-hydroxybenzenesulfonamide.
| Compound Name | 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-N-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 15236323 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-N-hydroxybenzenesulfonamide |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc(-c2ccccc2S(=O)(=O)NO)cc1 |
| InChI | InChI=1S/C23H24N4O3S/c1-4-21-25-22-15(2)13-16(3)24-23(22)27(21)14-17-9-11-18(12-10-17)19-7-5-6-8-20(19)31(29,30)26-28/h5-13,26,28H,4,14H2,1-3H3 |
| InChIKey | OYOOXKHMZCGCKY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|