C8H9IO3 — CID 15236394
(3aR,6aR)-5-iodo-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one (PubChem CID 15236394) has the molecular formula C8H9IO3 and a molecular weight of 280.06 g/mol. Its IUPAC name is (3aR,6aR)-5-iodo-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aR,6aR)-5-iodo-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 15236394 |
| Molecular Formula | C8H9IO3 |
| Molecular Weight | 280.06 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | (3aR,6aR)-5-iodo-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@@H]2C=C(I)C(=O)[C@@H]2O1 |
| InChI | InChI=1S/C8H9IO3/c1-8(2)11-5-3-4(9)6(10)7(5)12-8/h3,5,7H,1-2H3/t5-,7-/m1/s1 |
| InChIKey | BWJKJFQKVVHFRV-IYSWYEEDSA-N |
| XLogP | 1.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.06 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|