About [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate
[3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate (PubChem CID 15236678) has the molecular formula C35H31N5O3
and a molecular weight of 569.67 g/mol. Its IUPAC name is [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate |
| PubChem CID | 15236678 |
| Molecular Formula | C35H31N5O3 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1cc(-c2ccccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)no1 |
| InChI | InChI=1S/C35H31N5O3/c1-34(2,3)33(41)42-24-28-23-31(38-43-28)29-21-13-14-22-30(29)32-36-39-40(37-32)35(25-15-7-4-8-16-25,26-17-9-5-10-18-26)27-19-11-6-12-20-27/h4-23H,24H2,1-3H3 |
| InChIKey | JPFWYZDKAKJWIH-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 95.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate?
The IUPAC name of [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate (CID 15236678) is [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate.
What is the SMILES notation for [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate?
The canonical SMILES for [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OCc1cc(-c2ccccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)no1.
What is the InChIKey of [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate?
The InChIKey is JPFWYZDKAKJWIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H31N5O3/c1-34(2,3)33(41)42-24-28-23-31(38-43-28)29-21-13-14-22-30(29)32-36-39-40(37-32)35(25-15-7-4-8-16-25,26-17-9-5-10-18-26)27-19-11-6-12-20-27/h4-23H,24H2,1-3H3.
What are the key properties of [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate?
[3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate has a molecular weight of 569.67 g/mol, XLogP of 6.92, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(2-trityltetrazol-5-yl)phenyl]-1,2-oxazol-5-yl]methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 15236678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).