C23H42O2Si — CID 15236778
(2R,3R,4R)-3-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-oct-2-ynylcyclopentan-1-one (PubChem CID 15236778) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is (2R,3R,4R)-3-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-oct-2-ynylcyclopentan-1-one.
| Compound Name | (2R,3R,4R)-3-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-oct-2-ynylcyclopentan-1-one |
|---|---|
| PubChem CID | 15236778 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | (2R,3R,4R)-3-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-oct-2-ynylcyclopentan-1-one |
| SMILES | CCCCCC#CC[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCCC |
| InChI | InChI=1S/C23H42O2Si/c1-8-10-12-13-14-15-17-19-20(16-11-9-2)22(18-21(19)24)25-26(6,7)23(3,4)5/h19-20,22H,8-13,16-18H2,1-7H3/t19-,20-,22-/m1/s1 |
| InChIKey | ZHBQYRYJXKYYQN-KCZVDYSFSA-N |
| XLogP | 6.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|