C30H54O6Si — CID 15236853
[(1S,3R,4aS,7S,8S,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 15236853) has the molecular formula C30H54O6Si and a molecular weight of 538.84 g/mol. Its IUPAC name is [(1S,3R,4aS,7S,8S,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3R,4aS,7S,8S,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 15236853 |
| Molecular Formula | C30H54O6Si |
| Molecular Weight | 538.84 g/mol |
| Exact Mass | 538.37 |
| IUPAC Name | [(1S,3R,4aS,7S,8S,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2CC[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C30H54O6Si/c1-10-30(6,7)28(33)35-25-18-23(36-37(8,9)29(3,4)5)15-20-12-11-19(2)24(27(20)25)14-13-22-16-21(31)17-26(32)34-22/h19-25,27,31H,10-18H2,1-9H3/t19-,20-,21+,22+,23+,24-,25-,27-/m0/s1 |
| InChIKey | WZDUZAJQOHYYCY-JOQQIVMRSA-N |
| XLogP | 6.64 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.84 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|