About (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one
(4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one (PubChem CID 15236996) has the molecular formula C13H12O2
and a molecular weight of 200.24 g/mol. Its IUPAC name is (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one.
Molecular Properties
| Compound Name | (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one |
| PubChem CID | 15236996 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one |
| SMILES | O=C1C2CC#C/C=C\C#CC1(O)CCC2 |
| InChI | InChI=1S/C13H12O2/c14-12-11-7-4-2-1-3-5-9-13(12,15)10-6-8-11/h1,3,11,15H,6-8,10H2/b3-1- |
| InChIKey | BIDVYTBILXCYCK-IWQZZHSRSA-N |
| XLogP | 1.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one?
The IUPAC name of (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one (CID 15236996) is (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one.
What is the SMILES notation for (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one?
The canonical SMILES for (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one is O=C1C2CC#C/C=C\C#CC1(O)CCC2.
What is the InChIKey of (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one?
The InChIKey is BIDVYTBILXCYCK-IWQZZHSRSA-N. The full InChI is InChI=1S/C13H12O2/c14-12-11-7-4-2-1-3-5-9-13(12,15)10-6-8-11/h1,3,11,15H,6-8,10H2/b3-1-.
What are the key properties of (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one?
(4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one has a molecular weight of 200.24 g/mol, XLogP of 1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-1-hydroxybicyclo[7.3.1]tridec-4-en-2,6-diyn-13-one is sourced from PubChem (CID 15236996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).