C21H38O2Si — CID 15237476
(6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-6,10-dien-1-yn-3-ol (PubChem CID 15237476) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is (6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-6,10-dien-1-yn-3-ol.
| Compound Name | (6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-6,10-dien-1-yn-3-ol |
|---|---|
| PubChem CID | 15237476 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-6,10-dien-1-yn-3-ol |
| SMILES | C#CC(C)(O)CC/C=C(\C)CC/C=C(\C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O2Si/c1-10-21(7,22)16-12-15-18(2)13-11-14-19(3)17-23-24(8,9)20(4,5)6/h1,14-15,22H,11-13,16-17H2,2-9H3/b18-15+,19-14+ |
| InChIKey | KZZMBKJUJKRXQW-HTGWJEPXSA-N |
| XLogP | 5.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|