C46H56O6Si2 — CID 15237838
(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[2-[[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxooxolan-3-yl]methyl]prop-2-enyl]oxolan-2-one (PubChem CID 15237838) has the molecular formula C46H56O6Si2 and a molecular weight of 761.12 g/mol. Its IUPAC name is (3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[2-[[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxooxolan-3-yl]methyl]prop-2-enyl]oxolan-2-one.
| Compound Name | (3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[2-[[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxooxolan-3-yl]methyl]prop-2-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 15237838 |
| Molecular Formula | C46H56O6Si2 |
| Molecular Weight | 761.12 g/mol |
| Exact Mass | 760.36 |
| IUPAC Name | (3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[2-[[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxooxolan-3-yl]methyl]prop-2-enyl]oxolan-2-one |
| SMILES | C=C(C[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1=O)C[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C46H56O6Si2/c1-34(28-35-30-37(51-43(35)47)32-49-53(45(2,3)4,39-20-12-8-13-21-39)40-22-14-9-15-23-40)29-36-31-38(52-44(36)48)33-50-54(46(5,6)7,41-24-16-10-17-25-41)42-26-18-11-19-27-42/h8-27,35-38H,1,28-33H2,2-7H3/t35-,36-,37+,38+/m1/s1 |
| InChIKey | KEMHNOPOCJOLJW-RNATXAOGSA-N |
| XLogP | 7.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.12 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|