About 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate
2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate (PubChem CID 15239537) has the molecular formula C20H26N2O5Si
and a molecular weight of 402.52 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate |
| PubChem CID | 15239537 |
| Molecular Formula | C20H26N2O5Si |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate |
| SMILES | C=Cc1cccc(Oc2nc(OC)cc(OC)n2)c1C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C20H26N2O5Si/c1-7-14-9-8-10-15(18(14)19(23)26-11-12-28(4,5)6)27-20-21-16(24-2)13-17(22-20)25-3/h7-10,13H,1,11-12H2,2-6H3 |
| InChIKey | JAZQNQNEKLRNDR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate?
The IUPAC name of 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate (CID 15239537) is 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate.
What is the SMILES notation for 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate?
The canonical SMILES for 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate is C=Cc1cccc(Oc2nc(OC)cc(OC)n2)c1C(=O)OCC[Si](C)(C)C.
What is the InChIKey of 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate?
The InChIKey is JAZQNQNEKLRNDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O5Si/c1-7-14-9-8-10-15(18(14)19(23)26-11-12-28(4,5)6)27-20-21-16(24-2)13-17(22-20)25-3/h7-10,13H,1,11-12H2,2-6H3.
What are the key properties of 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate?
2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate has a molecular weight of 402.52 g/mol, XLogP of 4.42, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-ethenylbenzoate is sourced from PubChem (CID 15239537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).