C21H20Cl3NO — CID 15240656
2,3-dimethyl-4-phenyl-1-[2-(3,4,5-trichlorophenyl)propan-2-yl]-2H-pyrrol-5-one (PubChem CID 15240656) has the molecular formula C21H20Cl3NO and a molecular weight of 408.76 g/mol. Its IUPAC name is 2,3-dimethyl-4-phenyl-1-[2-(3,4,5-trichlorophenyl)propan-2-yl]-2H-pyrrol-5-one.
| Compound Name | 2,3-dimethyl-4-phenyl-1-[2-(3,4,5-trichlorophenyl)propan-2-yl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 15240656 |
| Molecular Formula | C21H20Cl3NO |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 2,3-dimethyl-4-phenyl-1-[2-(3,4,5-trichlorophenyl)propan-2-yl]-2H-pyrrol-5-one |
| SMILES | CC1=C(c2ccccc2)C(=O)N(C(C)(C)c2cc(Cl)c(Cl)c(Cl)c2)C1C |
| InChI | InChI=1S/C21H20Cl3NO/c1-12-13(2)25(20(26)18(12)14-8-6-5-7-9-14)21(3,4)15-10-16(22)19(24)17(23)11-15/h5-11,13H,1-4H3 |
| InChIKey | XFYAUQNDRBFHLO-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|