C25H22F6N2O — CID 15240955
6-[(4-methoxyphenyl)methyl]-5,11-bis(trifluoromethyl)-6a,7,8,9,10,10a-hexahydropyrido[4,3-b]carbazole (PubChem CID 15240955) has the molecular formula C25H22F6N2O and a molecular weight of 480.45 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methyl]-5,11-bis(trifluoromethyl)-6a,7,8,9,10,10a-hexahydropyrido[4,3-b]carbazole.
| Compound Name | 6-[(4-methoxyphenyl)methyl]-5,11-bis(trifluoromethyl)-6a,7,8,9,10,10a-hexahydropyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 15240955 |
| Molecular Formula | C25H22F6N2O |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 6-[(4-methoxyphenyl)methyl]-5,11-bis(trifluoromethyl)-6a,7,8,9,10,10a-hexahydropyrido[4,3-b]carbazole |
| SMILES | COc1ccc(CN2c3c(c(C(F)(F)F)c4cnccc4c3C(F)(F)F)C3CCCCC32)cc1 |
| InChI | InChI=1S/C25H22F6N2O/c1-34-15-8-6-14(7-9-15)13-33-19-5-3-2-4-17(19)20-21(24(26,27)28)18-12-32-11-10-16(18)22(23(20)33)25(29,30)31/h6-12,17,19H,2-5,13H2,1H3 |
| InChIKey | CYDYDECTFXGHGC-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |