C21H22O5 — CID 15241078
1,2,3,9,10-pentamethoxybenzo[a]heptalene (PubChem CID 15241078) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is 1,2,3,9,10-pentamethoxybenzo[a]heptalene.
| Compound Name | 1,2,3,9,10-pentamethoxybenzo[a]heptalene |
|---|---|
| PubChem CID | 15241078 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1,2,3,9,10-pentamethoxybenzo[a]heptalene |
| SMILES | COC1=C(OC)C=C2C=CC=c3cc(OC)c(OC)c(OC)c3=C2C=C1 |
| InChI | InChI=1S/C21H22O5/c1-22-16-10-9-15-13(11-17(16)23-2)7-6-8-14-12-18(24-3)20(25-4)21(26-5)19(14)15/h6-12H,1-5H3 |
| InChIKey | JSWBUBOOOIAOLK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |