About N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine
N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine (PubChem CID 15244462) has the molecular formula C13H12BrN
and a molecular weight of 262.15 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine |
| PubChem CID | 15244462 |
| Molecular Formula | C13H12BrN |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine |
| SMILES | C/C(=N\c1ccc(Br)cc1)C1=CC=CC1 |
| InChI | InChI=1S/C13H12BrN/c1-10(11-4-2-3-5-11)15-13-8-6-12(14)7-9-13/h2-4,6-9H,5H2,1H3/b15-10+ |
| InChIKey | YBXVMHXYTUPQBD-XNTDXEJSSA-N |
| XLogP | 4.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine?
The IUPAC name of N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine (CID 15244462) is N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine.
What is the SMILES notation for N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine?
The canonical SMILES for N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine is C/C(=N\c1ccc(Br)cc1)C1=CC=CC1.
What is the InChIKey of N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine?
The InChIKey is YBXVMHXYTUPQBD-XNTDXEJSSA-N. The full InChI is InChI=1S/C13H12BrN/c1-10(11-4-2-3-5-11)15-13-8-6-12(14)7-9-13/h2-4,6-9H,5H2,1H3/b15-10+.
What are the key properties of N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine?
N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine has a molecular weight of 262.15 g/mol, XLogP of 4.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine is sourced from PubChem (CID 15244462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).