C25H27NO — CID 15246558
(1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine (PubChem CID 15246558) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine.
| Compound Name | (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine |
|---|---|
| PubChem CID | 15246558 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine |
| SMILES | C=CC[C@H](N[C@@H](c1ccccc1)[C@H](OC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27NO/c1-3-13-23(20-14-7-4-8-15-20)26-24(21-16-9-5-10-17-21)25(27-2)22-18-11-6-12-19-22/h3-12,14-19,23-26H,1,13H2,2H3/t23-,24-,25+/m0/s1 |
| InChIKey | MLSJAZXILZAJRN-CCDWMCETSA-N |
| XLogP | 6.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|