About (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine
(1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine (PubChem CID 15246558) has the molecular formula C25H27NO
and a molecular weight of 357.50 g/mol. Its IUPAC name is (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine.
Molecular Properties
| Compound Name | (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine |
| PubChem CID | 15246558 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine |
| SMILES | C=CC[C@H](N[C@@H](c1ccccc1)[C@H](OC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27NO/c1-3-13-23(20-14-7-4-8-15-20)26-24(21-16-9-5-10-17-21)25(27-2)22-18-11-6-12-19-22/h3-12,14-19,23-26H,1,13H2,2H3/t23-,24-,25+/m0/s1 |
| InChIKey | MLSJAZXILZAJRN-CCDWMCETSA-N |
| XLogP | 6.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine?
The IUPAC name of (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine (CID 15246558) is (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine.
What is the SMILES notation for (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine?
The canonical SMILES for (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine is C=CC[C@H](N[C@@H](c1ccccc1)[C@H](OC)c1ccccc1)c1ccccc1.
What is the InChIKey of (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine?
The InChIKey is MLSJAZXILZAJRN-CCDWMCETSA-N. The full InChI is InChI=1S/C25H27NO/c1-3-13-23(20-14-7-4-8-15-20)26-24(21-16-9-5-10-17-21)25(27-2)22-18-11-6-12-19-22/h3-12,14-19,23-26H,1,13H2,2H3/t23-,24-,25+/m0/s1.
What are the key properties of (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine?
(1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine has a molecular weight of 357.50 g/mol, XLogP of 6.02, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylbut-3-en-1-amine is sourced from PubChem (CID 15246558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).