C26H27NOS — CID 15246926
2-tert-butyl-N-methyl-N,3,3-triphenylthiirane-2-carboxamide (PubChem CID 15246926) has the molecular formula C26H27NOS and a molecular weight of 401.58 g/mol. Its IUPAC name is 2-tert-butyl-N-methyl-N,3,3-triphenylthiirane-2-carboxamide.
| Compound Name | 2-tert-butyl-N-methyl-N,3,3-triphenylthiirane-2-carboxamide |
|---|---|
| PubChem CID | 15246926 |
| Molecular Formula | C26H27NOS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-tert-butyl-N-methyl-N,3,3-triphenylthiirane-2-carboxamide |
| SMILES | CN(C(=O)C1(C(C)(C)C)SC1(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NOS/c1-24(2,3)26(23(28)27(4)22-18-12-7-13-19-22)25(29-26,20-14-8-5-9-15-20)21-16-10-6-11-17-21/h5-19H,1-4H3 |
| InChIKey | STEBWHQPMLSKBZ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|