C10H8F8O — CID 15247581
3,6-bis(difluoromethylidene)-4-ethoxy-1,1,2,2-tetrafluorocyclohexane (PubChem CID 15247581) has the molecular formula C10H8F8O and a molecular weight of 296.16 g/mol. Its IUPAC name is 3,6-bis(difluoromethylidene)-4-ethoxy-1,1,2,2-tetrafluorocyclohexane.
| Compound Name | 3,6-bis(difluoromethylidene)-4-ethoxy-1,1,2,2-tetrafluorocyclohexane |
|---|---|
| PubChem CID | 15247581 |
| Molecular Formula | C10H8F8O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3,6-bis(difluoromethylidene)-4-ethoxy-1,1,2,2-tetrafluorocyclohexane |
| SMILES | CCOC1CC(=C(F)F)C(F)(F)C(F)(F)C1=C(F)F |
| InChI | InChI=1S/C10H8F8O/c1-2-19-5-3-4(7(11)12)9(15,16)10(17,18)6(5)8(13)14/h5H,2-3H2,1H3 |
| InChIKey | MQKBMMYOPBYUIY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|