C18H17BrO9 — CID 15247596
tetramethyl 1-bromo-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4,9-triene-4,5,9,10-tetracarboxylate (PubChem CID 15247596) has the molecular formula C18H17BrO9 and a molecular weight of 457.23 g/mol. Its IUPAC name is tetramethyl 1-bromo-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4,9-triene-4,5,9,10-tetracarboxylate.
| Compound Name | tetramethyl 1-bromo-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4,9-triene-4,5,9,10-tetracarboxylate |
|---|---|
| PubChem CID | 15247596 |
| Molecular Formula | C18H17BrO9 |
| Molecular Weight | 457.23 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | tetramethyl 1-bromo-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4,9-triene-4,5,9,10-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CC2=C(C1)C1OC2(Br)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C18H17BrO9/c1-24-14(20)7-5-9-10(6-8(7)15(21)25-2)18(19)12(17(23)27-4)11(13(9)28-18)16(22)26-3/h13H,5-6H2,1-4H3 |
| InChIKey | UEGGOFNBHXNQQU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|