C20H20O10 — CID 15247598
tetramethyl 1-acetyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4,9-triene-4,5,9,10-tetracarboxylate (PubChem CID 15247598) has the molecular formula C20H20O10 and a molecular weight of 420.37 g/mol. Its IUPAC name is tetramethyl 1-acetyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4,9-triene-4,5,9,10-tetracarboxylate.
| Compound Name | tetramethyl 1-acetyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4,9-triene-4,5,9,10-tetracarboxylate |
|---|---|
| PubChem CID | 15247598 |
| Molecular Formula | C20H20O10 |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | tetramethyl 1-acetyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4,9-triene-4,5,9,10-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CC2=C(C1)C1OC2(C(C)=O)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C20H20O10/c1-8(21)20-12-7-10(17(23)27-3)9(16(22)26-2)6-11(12)15(30-20)13(18(24)28-4)14(20)19(25)29-5/h15H,6-7H2,1-5H3 |
| InChIKey | HVPODSXMQJXZPL-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|