C22H26 — CID 15247724
(1S,6S)-1,6-bis(4-methylphenyl)bicyclo[4.2.0]octane (PubChem CID 15247724) has the molecular formula C22H26 and a molecular weight of 290.45 g/mol. Its IUPAC name is (1S,6S)-1,6-bis(4-methylphenyl)bicyclo[4.2.0]octane.
| Compound Name | (1S,6S)-1,6-bis(4-methylphenyl)bicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 15247724 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (1S,6S)-1,6-bis(4-methylphenyl)bicyclo[4.2.0]octane |
| SMILES | Cc1ccc([C@@]23CCCC[C@@]2(c2ccc(C)cc2)CC3)cc1 |
| InChI | InChI=1S/C22H26/c1-17-5-9-19(10-6-17)21-13-3-4-14-22(21,16-15-21)20-11-7-18(2)8-12-20/h5-12H,3-4,13-16H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | UGFGSSUOHQFVEU-VXKWHMMOSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |