C11H18O2 — CID 15248266
(1S,2R,4S,5R)-2,4-dimethoxybicyclo[3.2.2]non-6-ene (PubChem CID 15248266) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (1S,2R,4S,5R)-2,4-dimethoxybicyclo[3.2.2]non-6-ene.
| Compound Name | (1S,2R,4S,5R)-2,4-dimethoxybicyclo[3.2.2]non-6-ene |
|---|---|
| PubChem CID | 15248266 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (1S,2R,4S,5R)-2,4-dimethoxybicyclo[3.2.2]non-6-ene |
| SMILES | CO[C@H]1C[C@@H](OC)[C@@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C11H18O2/c1-12-10-7-11(13-2)9-5-3-8(10)4-6-9/h3,5,8-11H,4,6-7H2,1-2H3/t8-,9+,10-,11+ |
| InChIKey | ZMNXBJHZUFBWLD-DTIDVZRVSA-N |
| XLogP | 2.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|