C15H20Ru — CID 15248621
cyclopenta-1,3-diene;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;ruthenium(2+) (PubChem CID 15248621) has the molecular formula C15H20Ru and a molecular weight of 301.39 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;ruthenium(2+).
| Compound Name | cyclopenta-1,3-diene;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;ruthenium(2+) |
|---|---|
| PubChem CID | 15248621 |
| Molecular Formula | C15H20Ru |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | cyclopenta-1,3-diene;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;ruthenium(2+) |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[Ru+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C10H15.C5H5.Ru/c1-6-7(2)9(4)10(5)8(6)3;1-2-4-5-3-1;/h1-5H3;1-5H;/q2*-1;+2 |
| InChIKey | NMPXCALVUIDNLX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|