C17H28O5S — CID 15249281
dimethyl 2-[ethyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-lambda4-sulfanylidene]propanedioate (PubChem CID 15249281) has the molecular formula C17H28O5S and a molecular weight of 344.47 g/mol. Its IUPAC name is dimethyl 2-[ethyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-lambda4-sulfanylidene]propanedioate.
| Compound Name | dimethyl 2-[ethyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-lambda4-sulfanylidene]propanedioate |
|---|---|
| PubChem CID | 15249281 |
| Molecular Formula | C17H28O5S |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | dimethyl 2-[ethyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-lambda4-sulfanylidene]propanedioate |
| SMILES | CCS(C[C@]12CC[C@H](C[C@H]1O)C2(C)C)=C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C17H28O5S/c1-6-23(13(14(19)21-4)15(20)22-5)10-17-8-7-11(9-12(17)18)16(17,2)3/h11-12,18H,6-10H2,1-5H3/t11-,12-,17-,23?/m1/s1 |
| InChIKey | CQKLGLJNNVHKPY-CLAOXWAFSA-N |
| XLogP | 1.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|