About quinoxalino[2,3-a]phenazin-3-yl acetate
quinoxalino[2,3-a]phenazin-3-yl acetate (PubChem CID 15249326) has the molecular formula C20H12N4O2
and a molecular weight of 340.34 g/mol. Its IUPAC name is quinoxalino[2,3-a]phenazin-3-yl acetate.
Molecular Properties
| Compound Name | quinoxalino[2,3-a]phenazin-3-yl acetate |
| PubChem CID | 15249326 |
| Molecular Formula | C20H12N4O2 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | quinoxalino[2,3-a]phenazin-3-yl acetate |
| SMILES | CC(=O)Oc1ccc2nc3c(ccc4nc5ccccc5nc43)nc2c1 |
| InChI | InChI=1S/C20H12N4O2/c1-11(25)26-12-6-7-15-18(10-12)22-17-9-8-16-19(20(17)24-15)23-14-5-3-2-4-13(14)21-16/h2-10H,1H3 |
| InChIKey | SFKUTDXSBUVUTR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 77.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze quinoxalino[2,3-a]phenazin-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoxalino[2,3-a]phenazin-3-yl acetate?
The IUPAC name of quinoxalino[2,3-a]phenazin-3-yl acetate (CID 15249326) is quinoxalino[2,3-a]phenazin-3-yl acetate.
What is the SMILES notation for quinoxalino[2,3-a]phenazin-3-yl acetate?
The canonical SMILES for quinoxalino[2,3-a]phenazin-3-yl acetate is CC(=O)Oc1ccc2nc3c(ccc4nc5ccccc5nc43)nc2c1.
What is the InChIKey of quinoxalino[2,3-a]phenazin-3-yl acetate?
The InChIKey is SFKUTDXSBUVUTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N4O2/c1-11(25)26-12-6-7-15-18(10-12)22-17-9-8-16-19(20(17)24-15)23-14-5-3-2-4-13(14)21-16/h2-10H,1H3.
What are the key properties of quinoxalino[2,3-a]phenazin-3-yl acetate?
quinoxalino[2,3-a]phenazin-3-yl acetate has a molecular weight of 340.34 g/mol, XLogP of 3.80, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for quinoxalino[2,3-a]phenazin-3-yl acetate is sourced from PubChem (CID 15249326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).