C27H18N2O — CID 15249941
15,16-diphenyl-2-oxa-10,14-diazatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3,5,7,9,12,15,17-octaene (PubChem CID 15249941) has the molecular formula C27H18N2O and a molecular weight of 386.45 g/mol. Its IUPAC name is 15,16-diphenyl-2-oxa-10,14-diazatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3,5,7,9,12,15,17-octaene.
| Compound Name | 15,16-diphenyl-2-oxa-10,14-diazatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3,5,7,9,12,15,17-octaene |
|---|---|
| PubChem CID | 15249941 |
| Molecular Formula | C27H18N2O |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 15,16-diphenyl-2-oxa-10,14-diazatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3,5,7,9,12,15,17-octaene |
| SMILES | C1=Nc2cc3[nH]c(-c4ccccc4)c(-c4ccccc4)c3cc2Oc2ccccc21 |
| InChI | InChI=1S/C27H18N2O/c1-3-9-18(10-4-1)26-21-15-25-23(28-17-20-13-7-8-14-24(20)30-25)16-22(21)29-27(26)19-11-5-2-6-12-19/h1-17,29H |
| InChIKey | FPFVQDYPMRBCDM-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |