C22H17N3 — CID 15249942
2-methyl-6,7-diphenyl-1,5-dihydropyrrolo[2,3-f]benzimidazole (PubChem CID 15249942) has the molecular formula C22H17N3 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-methyl-6,7-diphenyl-1,5-dihydropyrrolo[2,3-f]benzimidazole.
| Compound Name | 2-methyl-6,7-diphenyl-1,5-dihydropyrrolo[2,3-f]benzimidazole |
|---|---|
| PubChem CID | 15249942 |
| Molecular Formula | C22H17N3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-methyl-6,7-diphenyl-1,5-dihydropyrrolo[2,3-f]benzimidazole |
| SMILES | Cc1nc2cc3[nH]c(-c4ccccc4)c(-c4ccccc4)c3cc2[nH]1 |
| InChI | InChI=1S/C22H17N3/c1-14-23-19-12-17-18(13-20(19)24-14)25-22(16-10-6-3-7-11-16)21(17)15-8-4-2-5-9-15/h2-13,25H,1H3,(H,23,24) |
| InChIKey | ABZGUCHXKUTXNM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |