C27H52N8O — CID 15250401
2-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 15250401) has the molecular formula C27H52N8O and a molecular weight of 504.77 g/mol. Its IUPAC name is 2-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 15250401 |
| Molecular Formula | C27H52N8O |
| Molecular Weight | 504.77 g/mol |
| Exact Mass | 504.43 |
| IUPAC Name | 2-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | CCN(c1nc(NCCO)nc(N(CC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C27H52N8O/c1-11-34(19-15-24(3,4)32-25(5,6)16-19)22-29-21(28-13-14-36)30-23(31-22)35(12-2)20-17-26(7,8)33-27(9,10)18-20/h19-20,32-33,36H,11-18H2,1-10H3,(H,28,29,30,31) |
| InChIKey | ISJWNYHTAYAVTH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.77 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |