C31H30ClF6N5O3 — CID 152505120
2-N-[4-[[3,5-bis(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]-2-methylphenyl]-6-chloro-1-(2-methyl-1-phenylmethoxypropan-2-yl)cyclohexa-3,5-diene-1,2-dicarboxamide (PubChem CID 152505120) has the molecular formula C31H30ClF6N5O3 and a molecular weight of 670.05 g/mol. Its IUPAC name is 2-N-[4-[[3,5-bis(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]-2-methylphenyl]-6-chloro-1-(2-methyl-1-phenylmethoxypropan-2-yl)cyclohexa-3,5-diene-1,2-dicarboxamide.
| Compound Name | 2-N-[4-[[3,5-bis(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]-2-methylphenyl]-6-chloro-1-(2-methyl-1-phenylmethoxypropan-2-yl)cyclohexa-3,5-diene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 152505120 |
| Molecular Formula | C31H30ClF6N5O3 |
| Molecular Weight | 670.05 g/mol |
| Exact Mass | 669.19 |
| IUPAC Name | 2-N-[4-[[3,5-bis(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]-2-methylphenyl]-6-chloro-1-(2-methyl-1-phenylmethoxypropan-2-yl)cyclohexa-3,5-diene-1,2-dicarboxamide |
| SMILES | Cc1cc(Cn2nc(C(F)(F)F)nc2C(F)(F)F)ccc1NC(=O)C1C=CC=C(Cl)C1(C(N)=O)C(C)(C)COCc1ccccc1 |
| InChI | InChI=1S/C31H30ClF6N5O3/c1-18-14-20(15-43-27(31(36,37)38)41-26(42-43)30(33,34)35)12-13-22(18)40-24(44)21-10-7-11-23(32)29(21,25(39)45)28(2,3)17-46-16-19-8-5-4-6-9-19/h4-14,21H,15-17H2,1-3H3,(H2,39,45)(H,40,44) |
| InChIKey | YEHDWGMTODVAJX-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.05 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |