C10H19N4O3+ — CID 152505898
3,4-dimethoxy-4-(2H-1,3,5-triazin-1-ylmethyl)morpholin-4-ium (PubChem CID 152505898) has the molecular formula C10H19N4O3+ and a molecular weight of 243.29 g/mol. Its IUPAC name is 3,4-dimethoxy-4-(2H-1,3,5-triazin-1-ylmethyl)morpholin-4-ium.
| Compound Name | 3,4-dimethoxy-4-(2H-1,3,5-triazin-1-ylmethyl)morpholin-4-ium |
|---|---|
| PubChem CID | 152505898 |
| Molecular Formula | C10H19N4O3+ |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 3,4-dimethoxy-4-(2H-1,3,5-triazin-1-ylmethyl)morpholin-4-ium |
| SMILES | COC1COCC[N+]1(CN1C=NC=NC1)OC |
| InChI | InChI=1S/C10H19N4O3/c1-15-10-5-17-4-3-14(10,16-2)9-13-7-11-6-12-8-13/h6-7,10H,3-5,8-9H2,1-2H3/q+1 |
| InChIKey | YELKSKPVUNGKNG-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|